C14H18N3O4+ — CID 6923407
methyl 4-[[2-[(2S)-3-oxopiperazin-1-ium-2-yl]acetyl]amino]benzoate (PubChem CID 6923407) has the molecular formula C14H18N3O4+ and a molecular weight of 292.32 g/mol. Its IUPAC name is methyl 4-[[2-[(2S)-3-oxopiperazin-1-ium-2-yl]acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-[(2S)-3-oxopiperazin-1-ium-2-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 6923407 |
| Molecular Formula | C14H18N3O4+ |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | methyl 4-[[2-[(2S)-3-oxopiperazin-1-ium-2-yl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C[C@@H]2[NH2+]CCNC2=O)cc1 |
| InChI | InChI=1S/C14H17N3O4/c1-21-14(20)9-2-4-10(5-3-9)17-12(18)8-11-13(19)16-7-6-15-11/h2-5,11,15H,6-8H2,1H3,(H,16,19)(H,17,18)/p+1/t11-/m0/s1 |
| InChIKey | FYQDLDQZUKTQQQ-NSHDSACASA-O |
| XLogP | -1.14 |
| TPSA | 101.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |