About (2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol
(2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 94451312) has the molecular formula C6H11N3O4S
and a molecular weight of 221.24 g/mol. Its IUPAC name is (2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol.
Molecular Properties
| Compound Name | (2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol |
| PubChem CID | 94451312 |
| Molecular Formula | C6H11N3O4S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | (2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | CS(=O)(=O)Cc1noc([C@H](N)CO)n1 |
| InChI | InChI=1S/C6H11N3O4S/c1-14(11,12)3-5-8-6(13-9-5)4(7)2-10/h4,10H,2-3,7H2,1H3/t4-/m1/s1 |
| InChIKey | HMQPWBJTCHTYKT-SCSAIBSYSA-N |
| XLogP | -1.39 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol?
The IUPAC name of (2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol (CID 94451312) is (2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol.
What is the SMILES notation for (2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol?
The canonical SMILES for (2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol is CS(=O)(=O)Cc1noc([C@H](N)CO)n1.
What is the InChIKey of (2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol?
The InChIKey is HMQPWBJTCHTYKT-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H11N3O4S/c1-14(11,12)3-5-8-6(13-9-5)4(7)2-10/h4,10H,2-3,7H2,1H3/t4-/m1/s1.
What are the key properties of (2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol?
(2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol has a molecular weight of 221.24 g/mol, XLogP of -1.39, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-2-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]ethanol is sourced from PubChem (CID 94451312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).