C15H18ClN3O4 — CID 94463249
N-[2-(2-chlorophenoxy)ethyl]-3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide (PubChem CID 94463249) has the molecular formula C15H18ClN3O4 and a molecular weight of 339.78 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)ethyl]-3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide.
| Compound Name | N-[2-(2-chlorophenoxy)ethyl]-3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 94463249 |
| Molecular Formula | C15H18ClN3O4 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-[2-(2-chlorophenoxy)ethyl]-3-[(4S)-2,5-dioxoimidazolidin-4-yl]-N-methylpropanamide |
| SMILES | CN(CCOc1ccccc1Cl)C(=O)CC[C@@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C15H18ClN3O4/c1-19(8-9-23-12-5-3-2-4-10(12)16)13(20)7-6-11-14(21)18-15(22)17-11/h2-5,11H,6-9H2,1H3,(H2,17,18,21,22)/t11-/m0/s1 |
| InChIKey | HALPYYIGJCYFBS-NSHDSACASA-N |
| XLogP | 1.17 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|