C17H14BrNO3S — CID 9446993
2-[(E)-2-(4-bromophenyl)ethenyl]-5-ethylsulfonyl-1,3-benzoxazole (PubChem CID 9446993) has the molecular formula C17H14BrNO3S and a molecular weight of 392.27 g/mol. Its IUPAC name is 2-[(E)-2-(4-bromophenyl)ethenyl]-5-ethylsulfonyl-1,3-benzoxazole.
| Compound Name | 2-[(E)-2-(4-bromophenyl)ethenyl]-5-ethylsulfonyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 9446993 |
| Molecular Formula | C17H14BrNO3S |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 2-[(E)-2-(4-bromophenyl)ethenyl]-5-ethylsulfonyl-1,3-benzoxazole |
| SMILES | CCS(=O)(=O)c1ccc2oc(/C=C/c3ccc(Br)cc3)nc2c1 |
| InChI | InChI=1S/C17H14BrNO3S/c1-2-23(20,21)14-8-9-16-15(11-14)19-17(22-16)10-5-12-3-6-13(18)7-4-12/h3-11H,2H2,1H3/b10-5+ |
| InChIKey | IHTOCQQBAGAASR-BJMVGYQFSA-N |
| XLogP | 4.55 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |