C16H15BrN2O3S — CID 25346032
N-(3-bromo-4-methylphenyl)-5-ethylsulfonyl-1,3-benzoxazol-2-amine (PubChem CID 25346032) has the molecular formula C16H15BrN2O3S and a molecular weight of 395.28 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-5-ethylsulfonyl-1,3-benzoxazol-2-amine.
| Compound Name | N-(3-bromo-4-methylphenyl)-5-ethylsulfonyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 25346032 |
| Molecular Formula | C16H15BrN2O3S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-5-ethylsulfonyl-1,3-benzoxazol-2-amine |
| SMILES | CCS(=O)(=O)c1ccc2oc(Nc3ccc(C)c(Br)c3)nc2c1 |
| InChI | InChI=1S/C16H15BrN2O3S/c1-3-23(20,21)12-6-7-15-14(9-12)19-16(22-15)18-11-5-4-10(2)13(17)8-11/h4-9H,3H2,1-2H3,(H,18,19) |
| InChIKey | UQKQRTVCOQAPGA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |