C17H18N2O4S — CID 2387945
N-(4-ethoxyphenyl)-5-ethylsulfonyl-1,3-benzoxazol-2-amine (PubChem CID 2387945) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-5-ethylsulfonyl-1,3-benzoxazol-2-amine.
| Compound Name | N-(4-ethoxyphenyl)-5-ethylsulfonyl-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 2387945 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-(4-ethoxyphenyl)-5-ethylsulfonyl-1,3-benzoxazol-2-amine |
| SMILES | CCOc1ccc(Nc2nc3cc(S(=O)(=O)CC)ccc3o2)cc1 |
| InChI | InChI=1S/C17H18N2O4S/c1-3-22-13-7-5-12(6-8-13)18-17-19-15-11-14(24(20,21)4-2)9-10-16(15)23-17/h5-11H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | RTAHDXWBBOXUTR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |