C20H17F2O6- — CID 9447772
2-[4-[(E)-3-[2-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]phenoxy]acetate (PubChem CID 9447772) has the molecular formula C20H17F2O6- and a molecular weight of 391.35 g/mol. Its IUPAC name is 2-[4-[(E)-3-[2-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]phenoxy]acetate.
| Compound Name | 2-[4-[(E)-3-[2-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9447772 |
| Molecular Formula | C20H17F2O6- |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-[4-[(E)-3-[2-(difluoromethoxy)-3-ethoxyphenyl]prop-2-enoyl]phenoxy]acetate |
| SMILES | CCOc1cccc(/C=C/C(=O)c2ccc(OCC(=O)[O-])cc2)c1OC(F)F |
| InChI | InChI=1S/C20H18F2O6/c1-2-26-17-5-3-4-14(19(17)28-20(21)22)8-11-16(23)13-6-9-15(10-7-13)27-12-18(24)25/h3-11,20H,2,12H2,1H3,(H,24,25)/p-1/b11-8+ |
| InChIKey | KMSKXCLFKOFURZ-DHZHZOJOSA-M |
| XLogP | 2.71 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|