C35H34N2O5 — CID 94479977
(6S,9S)-6-(2-phenylmethoxyphenyl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 94479977) has the molecular formula C35H34N2O5 and a molecular weight of 562.67 g/mol. Its IUPAC name is (6S,9S)-6-(2-phenylmethoxyphenyl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S,9S)-6-(2-phenylmethoxyphenyl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 94479977 |
| Molecular Formula | C35H34N2O5 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | (6S,9S)-6-(2-phenylmethoxyphenyl)-9-(3,4,5-trimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1cc([C@@H]2CC(=O)C3=C(C2)Nc2ccccc2N[C@H]3c2ccccc2OCc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C35H34N2O5/c1-39-31-19-24(20-32(40-2)35(31)41-3)23-17-28-33(29(38)18-23)34(37-27-15-9-8-14-26(27)36-28)25-13-7-10-16-30(25)42-21-22-11-5-4-6-12-22/h4-16,19-20,23,34,36-37H,17-18,21H2,1-3H3/t23-,34-/m0/s1 |
| InChIKey | SJBYNNBZRQSUQG-HUBRWUETSA-N |
| XLogP | 7.27 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |