C26H22Cl2N2O6S — CID 94482146
ethyl 2-[(2R)-2-(2,4-dichlorophenyl)-3-[hydroxy-(4-methoxy-2-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 94482146) has the molecular formula C26H22Cl2N2O6S and a molecular weight of 561.44 g/mol. Its IUPAC name is ethyl 2-[(2R)-2-(2,4-dichlorophenyl)-3-[hydroxy-(4-methoxy-2-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(2R)-2-(2,4-dichlorophenyl)-3-[hydroxy-(4-methoxy-2-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 94482146 |
| Molecular Formula | C26H22Cl2N2O6S |
| Molecular Weight | 561.44 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | ethyl 2-[(2R)-2-(2,4-dichlorophenyl)-3-[hydroxy-(4-methoxy-2-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N2C(=O)C(=O)C(=C(O)c3ccc(OC)cc3C)[C@@H]2c2ccc(Cl)cc2Cl)nc1C |
| InChI | InChI=1S/C26H22Cl2N2O6S/c1-5-36-25(34)23-13(3)29-26(37-23)30-20(17-8-6-14(27)11-18(17)28)19(22(32)24(30)33)21(31)16-9-7-15(35-4)10-12(16)2/h6-11,20,31H,5H2,1-4H3/t20-/m0/s1 |
| InChIKey | HAMUZUFPOMNCCY-FQEVSTJZSA-N |
| XLogP | 5.88 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|