C25H20Cl2N2O6S — CID 98386723
methyl 2-[(2R,3E)-2-(2,4-dichlorophenyl)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 98386723) has the molecular formula C25H20Cl2N2O6S and a molecular weight of 547.42 g/mol. Its IUPAC name is methyl 2-[(2R,3E)-2-(2,4-dichlorophenyl)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(2R,3E)-2-(2,4-dichlorophenyl)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 98386723 |
| Molecular Formula | C25H20Cl2N2O6S |
| Molecular Weight | 547.42 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | methyl 2-[(2R,3E)-2-(2,4-dichlorophenyl)-3-[hydroxy-(4-methoxy-3-methylphenyl)methylidene]-4,5-dioxopyrrolidin-1-yl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2C(=O)C(=O)/C(=C(/O)c3ccc(OC)c(C)c3)[C@@H]2c2ccc(Cl)cc2Cl)nc1C |
| InChI | InChI=1S/C25H20Cl2N2O6S/c1-11-9-13(5-8-17(11)34-3)20(30)18-19(15-7-6-14(26)10-16(15)27)29(23(32)21(18)31)25-28-12(2)22(36-25)24(33)35-4/h5-10,19,30H,1-4H3/b20-18+/t19-/m0/s1 |
| InChIKey | AKCWMBFAULDYHG-WOOAAIBNSA-N |
| XLogP | 5.49 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.42 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|