C34H29NO7 — CID 94483867
(5R)-1-benzyl-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 94483867) has the molecular formula C34H29NO7 and a molecular weight of 563.61 g/mol. Its IUPAC name is (5R)-1-benzyl-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-1-benzyl-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 94483867 |
| Molecular Formula | C34H29NO7 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | (5R)-1-benzyl-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc([C@@H]2C(=C(O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2Cc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C34H29NO7/c1-39-28-18-24(12-14-26(28)42-21-23-10-6-3-7-11-23)31-30(32(36)25-13-15-27-29(19-25)41-17-16-40-27)33(37)34(38)35(31)20-22-8-4-2-5-9-22/h2-15,18-19,31,36H,16-17,20-21H2,1H3/t31-/m1/s1 |
| InChIKey | KABSVXYFMBURGW-WJOKGBTCSA-N |
| XLogP | 5.67 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|