C36H33NO7 — CID 98382317
(4E,5R)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-ethoxy-4-phenylmethoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione (PubChem CID 98382317) has the molecular formula C36H33NO7 and a molecular weight of 591.66 g/mol. Its IUPAC name is (4E,5R)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-ethoxy-4-phenylmethoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-ethoxy-4-phenylmethoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98382317 |
| Molecular Formula | C36H33NO7 |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | (4E,5R)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-5-(3-ethoxy-4-phenylmethoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc([C@@H]2/C(=C(\O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2CCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H33NO7/c1-2-41-30-21-26(13-15-29(30)44-23-25-11-7-4-8-12-25)33-32(34(38)27-14-16-28-31(22-27)43-20-19-42-28)35(39)36(40)37(33)18-17-24-9-5-3-6-10-24/h3-16,21-22,33,38H,2,17-20,23H2,1H3/b34-32+/t33-/m1/s1 |
| InChIKey | BJWDZUBGSUEYBD-CFQDGGCTSA-N |
| XLogP | 6.10 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|