C37H35NO6 — CID 98374519
(4E,5R)-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione (PubChem CID 98374519) has the molecular formula C37H35NO6 and a molecular weight of 589.69 g/mol. Its IUPAC name is (4E,5R)-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98374519 |
| Molecular Formula | C37H35NO6 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.25 |
| IUPAC Name | (4E,5R)-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-1-(2-phenylethyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc([C@@H]2/C(=C(\O)c3ccc4c(c3)C[C@H](C)O4)C(=O)C(=O)N2CCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C37H35NO6/c1-3-42-32-22-27(14-17-31(32)43-23-26-12-8-5-9-13-26)34-33(35(39)28-15-16-30-29(21-28)20-24(2)44-30)36(40)37(41)38(34)19-18-25-10-6-4-7-11-25/h4-17,21-22,24,34,39H,3,18-20,23H2,1-2H3/b35-33+/t24-,34+/m0/s1 |
| InChIKey | YSGAQSHBVFVYGW-MFWFGDGVSA-N |
| XLogP | 6.65 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|