C36H33NO6 — CID 98324827
(4E,5S)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione (PubChem CID 98324827) has the molecular formula C36H33NO6 and a molecular weight of 575.66 g/mol. Its IUPAC name is (4E,5S)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98324827 |
| Molecular Formula | C36H33NO6 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | (4E,5S)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(3-methoxy-4-phenylmethoxyphenyl)-1-(2-phenylethyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc([C@H]2/C(=C(\O)c3ccc4c(c3)C[C@H](C)O4)C(=O)C(=O)N2CCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H33NO6/c1-23-19-28-20-27(14-15-29(28)43-23)34(38)32-33(37(36(40)35(32)39)18-17-24-9-5-3-6-10-24)26-13-16-30(31(21-26)41-2)42-22-25-11-7-4-8-12-25/h3-16,20-21,23,33,38H,17-19,22H2,1-2H3/b34-32+/t23-,33-/m0/s1 |
| InChIKey | QWLSKZDKAPHNSN-ANBMCXBTSA-N |
| XLogP | 6.26 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|