C36H42N2O6 — CID 6242488
(4Z)-1-[3-(diethylamino)propyl]-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione (PubChem CID 6242488) has the molecular formula C36H42N2O6 and a molecular weight of 598.74 g/mol. Its IUPAC name is (4Z)-1-[3-(diethylamino)propyl]-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-[3-(diethylamino)propyl]-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6242488 |
| Molecular Formula | C36H42N2O6 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | (4Z)-1-[3-(diethylamino)propyl]-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2/C(=C(/O)c3ccc4c(c3)CC(C)O4)C(=O)C(=O)N2CCCN(CC)CC)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H42N2O6/c1-5-37(6-2)18-11-19-38-33(26-14-17-30(31(22-26)42-7-3)43-23-25-12-9-8-10-13-25)32(35(40)36(38)41)34(39)27-15-16-29-28(21-27)20-24(4)44-29/h8-10,12-17,21-22,24,33,39H,5-7,11,18-20,23H2,1-4H3/b34-32- |
| InChIKey | QNEPBZKDRPXMKR-YJKCNMNRSA-N |
| XLogP | 6.14 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|