C34H38N2O5 — CID 98338496
(4E,5S)-1-[3-(diethylamino)propyl]-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 98338496) has the molecular formula C34H38N2O5 and a molecular weight of 554.69 g/mol. Its IUPAC name is (4E,5S)-1-[3-(diethylamino)propyl]-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-1-[3-(diethylamino)propyl]-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98338496 |
| Molecular Formula | C34H38N2O5 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | (4E,5S)-1-[3-(diethylamino)propyl]-4-[hydroxy-[(2R)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)CCCN1C(=O)C(=O)/C(=C(/O)c2ccc3c(c2)C[C@@H](C)O3)[C@@H]1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H38N2O5/c1-4-35(5-2)18-9-19-36-31(25-12-15-28(16-13-25)40-22-24-10-7-6-8-11-24)30(33(38)34(36)39)32(37)26-14-17-29-27(21-26)20-23(3)41-29/h6-8,10-17,21,23,31,37H,4-5,9,18-20,22H2,1-3H3/b32-30+/t23-,31+/m1/s1 |
| InChIKey | RPLYWORLYARGHG-OHIHJGSSSA-N |
| XLogP | 5.74 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|