C35H40N2O6 — CID 98381796
(4E,5S)-1-[2-(diethylamino)ethyl]-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione (PubChem CID 98381796) has the molecular formula C35H40N2O6 and a molecular weight of 584.71 g/mol. Its IUPAC name is (4E,5S)-1-[2-(diethylamino)ethyl]-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5S)-1-[2-(diethylamino)ethyl]-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98381796 |
| Molecular Formula | C35H40N2O6 |
| Molecular Weight | 584.71 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | (4E,5S)-1-[2-(diethylamino)ethyl]-5-(3-ethoxy-4-phenylmethoxyphenyl)-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cc([C@H]2/C(=C(\O)c3ccc4c(c3)C[C@H](C)O4)C(=O)C(=O)N2CCN(CC)CC)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H40N2O6/c1-5-36(6-2)17-18-37-32(25-13-16-29(30(21-25)41-7-3)42-22-24-11-9-8-10-12-24)31(34(39)35(37)40)33(38)26-14-15-28-27(20-26)19-23(4)43-28/h8-16,20-21,23,32,38H,5-7,17-19,22H2,1-4H3/b33-31+/t23-,32-/m0/s1 |
| InChIKey | HRJILUSBJGYUSW-ZAOVDLIJSA-N |
| XLogP | 5.75 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.71 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|