C33H44N2O6 — CID 98378260
(4E,5R)-1-[2-(diethylamino)ethyl]-5-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione (PubChem CID 98378260) has the molecular formula C33H44N2O6 and a molecular weight of 564.72 g/mol. Its IUPAC name is (4E,5R)-1-[2-(diethylamino)ethyl]-5-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E,5R)-1-[2-(diethylamino)ethyl]-5-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98378260 |
| Molecular Formula | C33H44N2O6 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | (4E,5R)-1-[2-(diethylamino)ethyl]-5-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4-[hydroxy-[(2S)-2-methyl-2,3-dihydro-1-benzofuran-5-yl]methylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1cc([C@@H]2/C(=C(\O)c3ccc4c(c3)C[C@H](C)O4)C(=O)C(=O)N2CCN(CC)CC)ccc1OCCC(C)C |
| InChI | InChI=1S/C33H44N2O6/c1-7-34(8-2)15-16-35-30(23-10-13-27(28(20-23)39-9-3)40-17-14-21(4)5)29(32(37)33(35)38)31(36)24-11-12-26-25(19-24)18-22(6)41-26/h10-13,19-22,30,36H,7-9,14-18H2,1-6H3/b31-29+/t22-,30+/m0/s1 |
| InChIKey | IPGDKDCXHZIEOB-QOISPNJLSA-N |
| XLogP | 5.60 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|