C24H23ClN2O3 — CID 94485952
2-[(2R,6R)-4-(4-chlorophenyl)-2-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-methoxyphenol (PubChem CID 94485952) has the molecular formula C24H23ClN2O3 and a molecular weight of 422.91 g/mol. Its IUPAC name is 2-[(2R,6R)-4-(4-chlorophenyl)-2-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-methoxyphenol.
| Compound Name | 2-[(2R,6R)-4-(4-chlorophenyl)-2-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-methoxyphenol |
|---|---|
| PubChem CID | 94485952 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-[(2R,6R)-4-(4-chlorophenyl)-2-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-6-methoxyphenol |
| SMILES | COc1cccc([C@H]2N=C(c3ccc(Cl)cc3)C[C@H](c3cccc(OC)c3O)N2)c1 |
| InChI | InChI=1S/C24H23ClN2O3/c1-29-18-6-3-5-16(13-18)24-26-20(15-9-11-17(25)12-10-15)14-21(27-24)19-7-4-8-22(30-2)23(19)28/h3-13,21,24,27-28H,14H2,1-2H3/t21-,24+/m1/s1 |
| InChIKey | VMTZICDTVHKJJU-QPPBQGQZSA-N |
| XLogP | 5.29 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|