C18H22N2O2S — CID 94502610
2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-N-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]acetamide (PubChem CID 94502610) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-N-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]acetamide.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-N-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]acetamide |
|---|---|
| PubChem CID | 94502610 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-N-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]acetamide |
| SMILES | Cc1nc(SCC(=O)NC[C@H]2CCCc3ccccc32)oc1C |
| InChI | InChI=1S/C18H22N2O2S/c1-12-13(2)22-18(20-12)23-11-17(21)19-10-15-8-5-7-14-6-3-4-9-16(14)15/h3-4,6,9,15H,5,7-8,10-11H2,1-2H3,(H,19,21)/t15-/m1/s1 |
| InChIKey | FFCOPPPXIBEZID-OAHLLOKOSA-N |
| XLogP | 3.62 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |