C17H21N3O4 — CID 9451598
(2S)-N-cyclopropyl-2-[(4R)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propanamide (PubChem CID 9451598) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-2-[(4R)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propanamide.
| Compound Name | (2S)-N-cyclopropyl-2-[(4R)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 9451598 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | (2S)-N-cyclopropyl-2-[(4R)-4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propanamide |
| SMILES | COc1cccc([C@@]2(C)NC(=O)N([C@@H](C)C(=O)NC3CC3)C2=O)c1 |
| InChI | InChI=1S/C17H21N3O4/c1-10(14(21)18-12-7-8-12)20-15(22)17(2,19-16(20)23)11-5-4-6-13(9-11)24-3/h4-6,9-10,12H,7-8H2,1-3H3,(H,18,21)(H,19,23)/t10-,17+/m0/s1 |
| InChIKey | QBUHBYALKCWECQ-DYZYQPBXSA-N |
| XLogP | 1.13 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|