C23H23ClN4O2 — CID 9452071
1-[2-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl-methylamino]acetyl]pyrrolidin-2-one (PubChem CID 9452071) has the molecular formula C23H23ClN4O2 and a molecular weight of 422.92 g/mol. Its IUPAC name is 1-[2-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl-methylamino]acetyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl-methylamino]acetyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 9452071 |
| Molecular Formula | C23H23ClN4O2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 1-[2-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl-methylamino]acetyl]pyrrolidin-2-one |
| SMILES | CN(CC(=O)N1CCCC1=O)Cc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H23ClN4O2/c1-26(16-22(30)27-13-5-8-21(27)29)14-18-15-28(20-6-3-2-4-7-20)25-23(18)17-9-11-19(24)12-10-17/h2-4,6-7,9-12,15H,5,8,13-14,16H2,1H3 |
| InChIKey | RQEYKLLSNZWVBV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |