C14H12N2O4S — CID 9452238
(2-amino-2-oxoethyl) 2-(thiophene-3-carbonylamino)benzoate (PubChem CID 9452238) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-(thiophene-3-carbonylamino)benzoate.
| Compound Name | (2-amino-2-oxoethyl) 2-(thiophene-3-carbonylamino)benzoate |
|---|---|
| PubChem CID | 9452238 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-(thiophene-3-carbonylamino)benzoate |
| SMILES | NC(=O)COC(=O)c1ccccc1NC(=O)c1ccsc1 |
| InChI | InChI=1S/C14H12N2O4S/c15-12(17)7-20-14(19)10-3-1-2-4-11(10)16-13(18)9-5-6-21-8-9/h1-6,8H,7H2,(H2,15,17)(H,16,18) |
| InChIKey | BTRUHADHZMXJPJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |