C20H30FN3O4S — CID 9452268
1-(4-fluorophenyl)sulfonyl-N-(2-methyl-2-morpholin-4-ylpropyl)piperidine-4-carboxamide (PubChem CID 9452268) has the molecular formula C20H30FN3O4S and a molecular weight of 427.54 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-(2-methyl-2-morpholin-4-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-(2-methyl-2-morpholin-4-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 9452268 |
| Molecular Formula | C20H30FN3O4S |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-(2-methyl-2-morpholin-4-ylpropyl)piperidine-4-carboxamide |
| SMILES | CC(C)(CNC(=O)C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C20H30FN3O4S/c1-20(2,23-11-13-28-14-12-23)15-22-19(25)16-7-9-24(10-8-16)29(26,27)18-5-3-17(21)4-6-18/h3-6,16H,7-15H2,1-2H3,(H,22,25) |
| InChIKey | SBDKDTQYCREJRI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |