C24H28N2O2 — CID 9452844
1-[(2R)-4-benzylmorpholin-2-yl]-N-[(2-methoxynaphthalen-1-yl)methyl]methanamine (PubChem CID 9452844) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-[(2R)-4-benzylmorpholin-2-yl]-N-[(2-methoxynaphthalen-1-yl)methyl]methanamine.
| Compound Name | 1-[(2R)-4-benzylmorpholin-2-yl]-N-[(2-methoxynaphthalen-1-yl)methyl]methanamine |
|---|---|
| PubChem CID | 9452844 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-[(2R)-4-benzylmorpholin-2-yl]-N-[(2-methoxynaphthalen-1-yl)methyl]methanamine |
| SMILES | COc1ccc2ccccc2c1CNC[C@@H]1CN(Cc2ccccc2)CCO1 |
| InChI | InChI=1S/C24H28N2O2/c1-27-24-12-11-20-9-5-6-10-22(20)23(24)16-25-15-21-18-26(13-14-28-21)17-19-7-3-2-4-8-19/h2-12,21,25H,13-18H2,1H3/t21-/m1/s1 |
| InChIKey | KESHAUNAYJBVIN-OAQYLSRUSA-N |
| XLogP | 3.84 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |