C19H21N3O2 — CID 94537942
(2S)-2-(5-oxo-1,4-diazepan-1-yl)-N,2-diphenylacetamide (PubChem CID 94537942) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is (2S)-2-(5-oxo-1,4-diazepan-1-yl)-N,2-diphenylacetamide.
| Compound Name | (2S)-2-(5-oxo-1,4-diazepan-1-yl)-N,2-diphenylacetamide |
|---|---|
| PubChem CID | 94537942 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (2S)-2-(5-oxo-1,4-diazepan-1-yl)-N,2-diphenylacetamide |
| SMILES | O=C1CCN([C@H](C(=O)Nc2ccccc2)c2ccccc2)CCN1 |
| InChI | InChI=1S/C19H21N3O2/c23-17-11-13-22(14-12-20-17)18(15-7-3-1-4-8-15)19(24)21-16-9-5-2-6-10-16/h1-10,18H,11-14H2,(H,20,23)(H,21,24)/t18-/m0/s1 |
| InChIKey | IUHSADLJDCVKDO-SFHVURJKSA-N |
| XLogP | 2.19 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |