C18H18FN3O4 — CID 94538703
N-[(5R)-7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]-2-(methylamino)-5-nitrobenzamide (PubChem CID 94538703) has the molecular formula C18H18FN3O4 and a molecular weight of 359.36 g/mol. Its IUPAC name is N-[(5R)-7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]-2-(methylamino)-5-nitrobenzamide.
| Compound Name | N-[(5R)-7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]-2-(methylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 94538703 |
| Molecular Formula | C18H18FN3O4 |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[(5R)-7-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl]-2-(methylamino)-5-nitrobenzamide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)N[C@@H]1CCCOc2ccc(F)cc21 |
| InChI | InChI=1S/C18H18FN3O4/c1-20-15-6-5-12(22(24)25)10-14(15)18(23)21-16-3-2-8-26-17-7-4-11(19)9-13(16)17/h4-7,9-10,16,20H,2-3,8H2,1H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | ZKJOLXGYTFZMRE-MRXNPFEDSA-N |
| XLogP | 3.42 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|