C20H19Cl2NO3 — CID 9454550
[(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 9454550) has the molecular formula C20H19Cl2NO3 and a molecular weight of 392.28 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 9454550 |
| Molecular Formula | C20H19Cl2NO3 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | [(2S)-1-oxo-1-(2-phenylanilino)propan-2-yl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | C[C@H](OC(=O)[C@]1(C)CC1(Cl)Cl)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C20H19Cl2NO3/c1-13(26-18(25)19(2)12-20(19,21)22)17(24)23-16-11-7-6-10-15(16)14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3,(H,23,24)/t13-,19-/m0/s1 |
| InChIKey | KOHFFWUAKILDIK-DJJJIMSYSA-N |
| XLogP | 4.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|