C14H16N2O5S — CID 94551587
(1R)-N-(2-methyl-4-nitrophenyl)sulfonylcyclohex-3-ene-1-carboxamide (PubChem CID 94551587) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is (1R)-N-(2-methyl-4-nitrophenyl)sulfonylcyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-(2-methyl-4-nitrophenyl)sulfonylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 94551587 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (1R)-N-(2-methyl-4-nitrophenyl)sulfonylcyclohex-3-ene-1-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1S(=O)(=O)NC(=O)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C14H16N2O5S/c1-10-9-12(16(18)19)7-8-13(10)22(20,21)15-14(17)11-5-3-2-4-6-11/h2-3,7-9,11H,4-6H2,1H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | CKVIXXUHHVVIIJ-NSHDSACASA-N |
| XLogP | 2.06 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|