About N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine
N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine (PubChem CID 94558259) has the molecular formula C12H14F3NO
and a molecular weight of 245.24 g/mol. Its IUPAC name is N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine.
Molecular Properties
| Compound Name | N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine |
| PubChem CID | 94558259 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine |
| SMILES | CNC[C@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H14F3NO/c1-16-7-9-6-11(9)8-2-4-10(5-3-8)17-12(13,14)15/h2-5,9,11,16H,6-7H2,1H3/t9-,11-/m1/s1 |
| InChIKey | UIVWDSBDSZGDDA-MWLCHTKSSA-N |
| XLogP | 2.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine?
The IUPAC name of N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine (CID 94558259) is N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine.
What is the SMILES notation for N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine?
The canonical SMILES for N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine is CNC[C@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1.
What is the InChIKey of N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine?
The InChIKey is UIVWDSBDSZGDDA-MWLCHTKSSA-N. The full InChI is InChI=1S/C12H14F3NO/c1-16-7-9-6-11(9)8-2-4-10(5-3-8)17-12(13,14)15/h2-5,9,11,16H,6-7H2,1H3/t9-,11-/m1/s1.
What are the key properties of N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine?
N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine has a molecular weight of 245.24 g/mol, XLogP of 2.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-[(1S,2S)-2-[4-(trifluoromethoxy)phenyl]cyclopropyl]methanamine is sourced from PubChem (CID 94558259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).