C20H19N3O3 — CID 945686
2-anilino-9,10-dimethoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one (PubChem CID 945686) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-anilino-9,10-dimethoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one.
| Compound Name | 2-anilino-9,10-dimethoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
|---|---|
| PubChem CID | 945686 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-anilino-9,10-dimethoxy-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one |
| SMILES | COc1cc2c(cc1OC)-c1cc(Nc3ccccc3)nc(=O)n1CC2 |
| InChI | InChI=1S/C20H19N3O3/c1-25-17-10-13-8-9-23-16(15(13)11-18(17)26-2)12-19(22-20(23)24)21-14-6-4-3-5-7-14/h3-7,10-12H,8-9H2,1-2H3,(H,21,22,24) |
| InChIKey | OHTOTKYOBIXMDC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |