C17H13NO4S — CID 94591978
2-[2-[(E)-2-cyano-3-(3-methylthiophen-2-yl)-3-oxoprop-1-enyl]phenoxy]acetic acid (PubChem CID 94591978) has the molecular formula C17H13NO4S and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-[2-[(E)-2-cyano-3-(3-methylthiophen-2-yl)-3-oxoprop-1-enyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-2-cyano-3-(3-methylthiophen-2-yl)-3-oxoprop-1-enyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 94591978 |
| Molecular Formula | C17H13NO4S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 2-[2-[(E)-2-cyano-3-(3-methylthiophen-2-yl)-3-oxoprop-1-enyl]phenoxy]acetic acid |
| SMILES | Cc1ccsc1C(=O)/C(C#N)=C/c1ccccc1OCC(=O)O |
| InChI | InChI=1S/C17H13NO4S/c1-11-6-7-23-17(11)16(21)13(9-18)8-12-4-2-3-5-14(12)22-10-15(19)20/h2-8H,10H2,1H3,(H,19,20)/b13-8+ |
| InChIKey | BKZKVKQQLWLABW-MDWZMJQESA-N |
| XLogP | 3.31 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|