C17H18BrN3O2S — CID 94592234
2-[(Z)-[amino-(4-bromothiophen-2-yl)methylidene]amino]oxy-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 94592234) has the molecular formula C17H18BrN3O2S and a molecular weight of 408.32 g/mol. Its IUPAC name is 2-[(Z)-[amino-(4-bromothiophen-2-yl)methylidene]amino]oxy-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-[(Z)-[amino-(4-bromothiophen-2-yl)methylidene]amino]oxy-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 94592234 |
| Molecular Formula | C17H18BrN3O2S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 2-[(Z)-[amino-(4-bromothiophen-2-yl)methylidene]amino]oxy-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | N/C(=N\OCC(=O)N[C@H]1CCCc2ccccc21)c1cc(Br)cs1 |
| InChI | InChI=1S/C17H18BrN3O2S/c18-12-8-15(24-10-12)17(19)21-23-9-16(22)20-14-7-3-5-11-4-1-2-6-13(11)14/h1-2,4,6,8,10,14H,3,5,7,9H2,(H2,19,21)(H,20,22)/t14-/m0/s1 |
| InChIKey | RLEMIHAPWHHYAZ-AWEZNQCLSA-N |
| XLogP | 3.34 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|