C21H25NO3 — CID 94596120
(2S)-1-[4-(4-hydroxyphenyl)piperidin-1-yl]-2-(4-methylphenoxy)propan-1-one (PubChem CID 94596120) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (2S)-1-[4-(4-hydroxyphenyl)piperidin-1-yl]-2-(4-methylphenoxy)propan-1-one.
| Compound Name | (2S)-1-[4-(4-hydroxyphenyl)piperidin-1-yl]-2-(4-methylphenoxy)propan-1-one |
|---|---|
| PubChem CID | 94596120 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2S)-1-[4-(4-hydroxyphenyl)piperidin-1-yl]-2-(4-methylphenoxy)propan-1-one |
| SMILES | Cc1ccc(O[C@@H](C)C(=O)N2CCC(c3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H25NO3/c1-15-3-9-20(10-4-15)25-16(2)21(24)22-13-11-18(12-14-22)17-5-7-19(23)8-6-17/h3-10,16,18,23H,11-14H2,1-2H3/t16-/m0/s1 |
| InChIKey | KBEFOYJKIYVKPX-INIZCTEOSA-N |
| XLogP | 3.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |