C25H32N2O5 — CID 108553423
N-[1-[2-(4-hydroxyphenoxy)propanoyl]piperidin-4-yl]-4-(4-methylphenoxy)butanamide (PubChem CID 108553423) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-[1-[2-(4-hydroxyphenoxy)propanoyl]piperidin-4-yl]-4-(4-methylphenoxy)butanamide.
| Compound Name | N-[1-[2-(4-hydroxyphenoxy)propanoyl]piperidin-4-yl]-4-(4-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 108553423 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N-[1-[2-(4-hydroxyphenoxy)propanoyl]piperidin-4-yl]-4-(4-methylphenoxy)butanamide |
| SMILES | Cc1ccc(OCCCC(=O)NC2CCN(C(=O)C(C)Oc3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H32N2O5/c1-18-5-9-22(10-6-18)31-17-3-4-24(29)26-20-13-15-27(16-14-20)25(30)19(2)32-23-11-7-21(28)8-12-23/h5-12,19-20,28H,3-4,13-17H2,1-2H3,(H,26,29) |
| InChIKey | YKHORXBWFIOZAS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|