C17H23ClN2O4 — CID 108564305
3-chloro-N-[1-[2-(4-hydroxyphenoxy)propanoyl]piperidin-4-yl]propanamide (PubChem CID 108564305) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is 3-chloro-N-[1-[2-(4-hydroxyphenoxy)propanoyl]piperidin-4-yl]propanamide.
| Compound Name | 3-chloro-N-[1-[2-(4-hydroxyphenoxy)propanoyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108564305 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 3-chloro-N-[1-[2-(4-hydroxyphenoxy)propanoyl]piperidin-4-yl]propanamide |
| SMILES | CC(Oc1ccc(O)cc1)C(=O)N1CCC(NC(=O)CCCl)CC1 |
| InChI | InChI=1S/C17H23ClN2O4/c1-12(24-15-4-2-14(21)3-5-15)17(23)20-10-7-13(8-11-20)19-16(22)6-9-18/h2-5,12-13,21H,6-11H2,1H3,(H,19,22) |
| InChIKey | SGBJZFUUDINPJA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|