C23H28N2O4 — CID 108557567
N-[1-[2-(4-hydroxyphenoxy)propanoyl]piperidin-4-yl]-3,4-dimethylbenzamide (PubChem CID 108557567) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[1-[2-(4-hydroxyphenoxy)propanoyl]piperidin-4-yl]-3,4-dimethylbenzamide.
| Compound Name | N-[1-[2-(4-hydroxyphenoxy)propanoyl]piperidin-4-yl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 108557567 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-[1-[2-(4-hydroxyphenoxy)propanoyl]piperidin-4-yl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(C(=O)C(C)Oc3ccc(O)cc3)CC2)cc1C |
| InChI | InChI=1S/C23H28N2O4/c1-15-4-5-18(14-16(15)2)22(27)24-19-10-12-25(13-11-19)23(28)17(3)29-21-8-6-20(26)7-9-21/h4-9,14,17,19,26H,10-13H2,1-3H3,(H,24,27) |
| InChIKey | WQJHZQLOVZXMMP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |