C16H17ClN2O4 — CID 94599129
(1S,6R)-6-[[3-chloro-4-(methylcarbamoyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 94599129) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is (1S,6R)-6-[[3-chloro-4-(methylcarbamoyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | (1S,6R)-6-[[3-chloro-4-(methylcarbamoyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 94599129 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (1S,6R)-6-[[3-chloro-4-(methylcarbamoyl)phenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CNC(=O)c1ccc(NC(=O)[C@@H]2CC=CC[C@@H]2C(=O)O)cc1Cl |
| InChI | InChI=1S/C16H17ClN2O4/c1-18-14(20)12-7-6-9(8-13(12)17)19-15(21)10-4-2-3-5-11(10)16(22)23/h2-3,6-8,10-11H,4-5H2,1H3,(H,18,20)(H,19,21)(H,22,23)/t10-,11+/m1/s1 |
| InChIKey | ZZRMAYBVAHXFRN-MNOVXSKESA-N |
| XLogP | 2.31 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|