C22H29N3O3 — CID 9461984
(2R)-N-[(2-methoxyphenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]propanamide (PubChem CID 9461984) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is (2R)-N-[(2-methoxyphenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-[(2-methoxyphenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 9461984 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | (2R)-N-[(2-methoxyphenyl)methyl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]propanamide |
| SMILES | COc1ccc(N2CCN([C@H](C)C(=O)NCc3ccccc3OC)CC2)cc1 |
| InChI | InChI=1S/C22H29N3O3/c1-17(22(26)23-16-18-6-4-5-7-21(18)28-3)24-12-14-25(15-13-24)19-8-10-20(27-2)11-9-19/h4-11,17H,12-16H2,1-3H3,(H,23,26)/t17-/m1/s1 |
| InChIKey | CDUZFKDCAIFWIQ-QGZVFWFLSA-N |
| XLogP | 2.53 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|