C24H30N4O3 — CID 9462111
4-[(2S)-2-[4-(4-methoxyphenyl)piperazin-1-yl]propanoyl]-3,3-dimethyl-1H-quinoxalin-2-one (PubChem CID 9462111) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-[(2S)-2-[4-(4-methoxyphenyl)piperazin-1-yl]propanoyl]-3,3-dimethyl-1H-quinoxalin-2-one.
| Compound Name | 4-[(2S)-2-[4-(4-methoxyphenyl)piperazin-1-yl]propanoyl]-3,3-dimethyl-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 9462111 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 4-[(2S)-2-[4-(4-methoxyphenyl)piperazin-1-yl]propanoyl]-3,3-dimethyl-1H-quinoxalin-2-one |
| SMILES | COc1ccc(N2CCN([C@@H](C)C(=O)N3c4ccccc4NC(=O)C3(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H30N4O3/c1-17(26-13-15-27(16-14-26)18-9-11-19(31-4)12-10-18)22(29)28-21-8-6-5-7-20(21)25-23(30)24(28,2)3/h5-12,17H,13-16H2,1-4H3,(H,25,30)/t17-/m0/s1 |
| InChIKey | HLKNHDMQDNPKJH-KRWDZBQOSA-N |
| XLogP | 2.97 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|