C16H14F2N2OS — CID 9462335
N-[(Z)-1-(2,4-difluorophenyl)ethylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide (PubChem CID 9462335) has the molecular formula C16H14F2N2OS and a molecular weight of 320.36 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-difluorophenyl)ethylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-1-(2,4-difluorophenyl)ethylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9462335 |
| Molecular Formula | C16H14F2N2OS |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-[(Z)-1-(2,4-difluorophenyl)ethylideneamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1cc2c(s1)CCC2)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H14F2N2OS/c1-9(12-6-5-11(17)8-13(12)18)19-20-16(21)15-7-10-3-2-4-14(10)22-15/h5-8H,2-4H2,1H3,(H,20,21)/b19-9- |
| InChIKey | NQIMXWNZETYSGC-OCKHKDLRSA-N |
| XLogP | 3.67 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|