C17H16Cl2N2OS — CID 3981641
N-[1-(3,4-dichlorophenyl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 3981641) has the molecular formula C17H16Cl2N2OS and a molecular weight of 367.30 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3981641 |
| Molecular Formula | C17H16Cl2N2OS |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CC(=NNC(=O)c1cc2c(s1)CCCC2)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2OS/c1-10(11-6-7-13(18)14(19)8-11)20-21-17(22)16-9-12-4-2-3-5-15(12)23-16/h6-9H,2-5H2,1H3,(H,21,22) |
| InChIKey | RMKFDTFJGWIPGS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|