C14H16BrFN2O2 — CID 94631257
(3R)-N-[2-(3-bromo-4-fluorophenyl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 94631257) has the molecular formula C14H16BrFN2O2 and a molecular weight of 343.20 g/mol. Its IUPAC name is (3R)-N-[2-(3-bromo-4-fluorophenyl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[2-(3-bromo-4-fluorophenyl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94631257 |
| Molecular Formula | C14H16BrFN2O2 |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (3R)-N-[2-(3-bromo-4-fluorophenyl)ethyl]-1-methyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN1C[C@H](C(=O)NCCc2ccc(F)c(Br)c2)CC1=O |
| InChI | InChI=1S/C14H16BrFN2O2/c1-18-8-10(7-13(18)19)14(20)17-5-4-9-2-3-12(16)11(15)6-9/h2-3,6,10H,4-5,7-8H2,1H3,(H,17,20)/t10-/m1/s1 |
| InChIKey | SPUSHMRFSYBIMI-SNVBAGLBSA-N |
| XLogP | 1.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |