C18H28N3O2+ — CID 9464030
dimethyl-[(1R)-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]-1-phenylethyl]azanium (PubChem CID 9464030) has the molecular formula C18H28N3O2+ and a molecular weight of 318.44 g/mol. Its IUPAC name is dimethyl-[(1R)-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]-1-phenylethyl]azanium.
| Compound Name | dimethyl-[(1R)-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 9464030 |
| Molecular Formula | C18H28N3O2+ |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | dimethyl-[(1R)-2-[[2-(2-oxoazepan-1-yl)acetyl]amino]-1-phenylethyl]azanium |
| SMILES | C[NH+](C)[C@@H](CNC(=O)CN1CCCCCC1=O)c1ccccc1 |
| InChI | InChI=1S/C18H27N3O2/c1-20(2)16(15-9-5-3-6-10-15)13-19-17(22)14-21-12-8-4-7-11-18(21)23/h3,5-6,9-10,16H,4,7-8,11-14H2,1-2H3,(H,19,22)/p+1/t16-/m0/s1 |
| InChIKey | GDCUBEDQOWSOFJ-INIZCTEOSA-O |
| XLogP | 0.39 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |