C16H20N4O2 — CID 94643423
[(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanone (PubChem CID 94643423) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is [(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanone.
| Compound Name | [(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanone |
|---|---|
| PubChem CID | 94643423 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(4aS,7aR)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl]-(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)methanone |
| SMILES | Cc1nn(C)c2ncc(C(=O)N3CCO[C@@H]4CCC[C@@H]43)cc12 |
| InChI | InChI=1S/C16H20N4O2/c1-10-12-8-11(9-17-15(12)19(2)18-10)16(21)20-6-7-22-14-5-3-4-13(14)20/h8-9,13-14H,3-7H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | GPGFWHKEUIKSGU-UONOGXRCSA-N |
| XLogP | 1.67 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |