C20H21N3O3 — CID 94647683
N-[2-[[(2S)-oxan-2-yl]methoxy]phenyl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 94647683) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[2-[[(2S)-oxan-2-yl]methoxy]phenyl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[2-[[(2S)-oxan-2-yl]methoxy]phenyl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 94647683 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[2-[[(2S)-oxan-2-yl]methoxy]phenyl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1OC[C@@H]1CCCCO1)c1cn2ccccc2n1 |
| InChI | InChI=1S/C20H21N3O3/c24-20(17-13-23-11-5-3-10-19(23)21-17)22-16-8-1-2-9-18(16)26-14-15-7-4-6-12-25-15/h1-3,5,8-11,13,15H,4,6-7,12,14H2,(H,22,24)/t15-/m0/s1 |
| InChIKey | GOYPQPPCWVUCNC-HNNXBMFYSA-N |
| XLogP | 3.53 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |