C13H15N3O2 — CID 94184886
N-[[(2S)-oxolan-2-yl]methyl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 94184886) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 94184886 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1cn2ccccc2n1 |
| InChI | InChI=1S/C13H15N3O2/c17-13(14-8-10-4-3-7-18-10)11-9-16-6-2-1-5-12(16)15-11/h1-2,5-6,9-10H,3-4,7-8H2,(H,14,17)/t10-/m0/s1 |
| InChIKey | GMHXOFHDXRDMJX-JTQLQIEISA-N |
| XLogP | 1.24 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |