C16H17ClN4OS — CID 9465564
3-[(4-chlorophenoxy)methyl]-4-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 9465564) has the molecular formula C16H17ClN4OS and a molecular weight of 348.86 g/mol. Its IUPAC name is 3-[(4-chlorophenoxy)methyl]-4-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(4-chlorophenoxy)methyl]-4-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9465564 |
| Molecular Formula | C16H17ClN4OS |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 3-[(4-chlorophenoxy)methyl]-4-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(COc2ccc(Cl)cc2)n1/N=C\[C@H]1CC=CCC1 |
| InChI | InChI=1S/C16H17ClN4OS/c17-13-6-8-14(9-7-13)22-11-15-19-20-16(23)21(15)18-10-12-4-2-1-3-5-12/h1-2,6-10,12H,3-5,11H2,(H,20,23)/b18-10-/t12-/m0/s1 |
| InChIKey | QIWLZAPKKFWQGN-XACIZNRCSA-N |
| XLogP | 4.36 |
| TPSA | 55.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|