C12H16N4S — CID 9358080
4-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione (PubChem CID 9358080) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 4-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 9358080 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 4-[(Z)-[(1R)-cyclohex-3-en-1-yl]methylideneamino]-3-cyclopropyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(C2CC2)n1/N=C\[C@H]1CC=CCC1 |
| InChI | InChI=1S/C12H16N4S/c17-12-15-14-11(10-6-7-10)16(12)13-8-9-4-2-1-3-5-9/h1-2,8-10H,3-7H2,(H,15,17)/b13-8-/t9-/m0/s1 |
| InChIKey | LZTXDXMXWHUYAW-LMRAXHDRSA-N |
| XLogP | 3.01 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|