C23H26N4O4 — CID 9466295
3-butyl-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-4-oxophthalazine-1-carboxamide (PubChem CID 9466295) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-butyl-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-butyl-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9466295 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-butyl-N-[(Z)-1-(2,4-dimethoxyphenyl)ethylideneamino]-4-oxophthalazine-1-carboxamide |
| SMILES | CCCCn1nc(C(=O)N/N=C(/C)c2ccc(OC)cc2OC)c2ccccc2c1=O |
| InChI | InChI=1S/C23H26N4O4/c1-5-6-13-27-23(29)19-10-8-7-9-18(19)21(26-27)22(28)25-24-15(2)17-12-11-16(30-3)14-20(17)31-4/h7-12,14H,5-6,13H2,1-4H3,(H,25,28)/b24-15- |
| InChIKey | SIUJKXCSHCSYLY-IWIPYMOSSA-N |
| XLogP | 3.37 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|